C26H6N8 — CID 140955973
10,11,12-triisocyano-3,6-diazapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene-4,5,9-tricarbonitrile (PubChem CID 140955973) has the molecular formula C26H6N8 and a molecular weight of 430.39 g/mol. Its IUPAC name is 10,11,12-triisocyano-3,6-diazapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene-4,5,9-tricarbonitrile.
| Compound Name | 10,11,12-triisocyano-3,6-diazapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene-4,5,9-tricarbonitrile |
|---|---|
| PubChem CID | 140955973 |
| Molecular Formula | C26H6N8 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 10,11,12-triisocyano-3,6-diazapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene-4,5,9-tricarbonitrile |
| SMILES | [C-]#[N+]c1c([N+]#[C-])c([N+]#[C-])c2c(c1C#N)c1nc(C#N)c(C#N)nc1c1ccc3ccccc3c12 |
| InChI | InChI=1S/C26H6N8/c1-30-22-16(10-27)20-21(24(31-2)26(22)32-3)19-14-7-5-4-6-13(14)8-9-15(19)23-25(20)34-18(12-29)17(11-28)33-23/h4-9H |
| InChIKey | HKAWHZHIHUWNQB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 110.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|