C28H10N6 — CID 139436239
3,6-diazahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2,4,6,8(13),9,11,15,17,19,21,23,25-tridecaene-4,5,10,11-tetracarbonitrile (PubChem CID 139436239) has the molecular formula C28H10N6 and a molecular weight of 430.43 g/mol. Its IUPAC name is 3,6-diazahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2,4,6,8(13),9,11,15,17,19,21,23,25-tridecaene-4,5,10,11-tetracarbonitrile.
| Compound Name | 3,6-diazahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2,4,6,8(13),9,11,15,17,19,21,23,25-tridecaene-4,5,10,11-tetracarbonitrile |
|---|---|
| PubChem CID | 139436239 |
| Molecular Formula | C28H10N6 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 3,6-diazahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2,4,6,8(13),9,11,15,17,19,21,23,25-tridecaene-4,5,10,11-tetracarbonitrile |
| SMILES | N#Cc1cc2c(cc1C#N)c1c3ccccc3c3ccccc3c1c1nc(C#N)c(C#N)nc21 |
| InChI | InChI=1S/C28H10N6/c29-11-15-9-21-22(10-16(15)12-30)27-28(34-24(14-32)23(13-31)33-27)26-20-8-4-2-6-18(20)17-5-1-3-7-19(17)25(21)26/h1-10H |
| InChIKey | ATOJRXFMGGSZRM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 120.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|