C21H4N10 — CID 167179391
8-methylpyrazino[2,3-f][1,7]phenanthroline-2,3,6,7,10,11-hexacarbonitrile (PubChem CID 167179391) has the molecular formula C21H4N10 and a molecular weight of 396.33 g/mol. Its IUPAC name is 8-methylpyrazino[2,3-f][1,7]phenanthroline-2,3,6,7,10,11-hexacarbonitrile.
| Compound Name | 8-methylpyrazino[2,3-f][1,7]phenanthroline-2,3,6,7,10,11-hexacarbonitrile |
|---|---|
| PubChem CID | 167179391 |
| Molecular Formula | C21H4N10 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 8-methylpyrazino[2,3-f][1,7]phenanthroline-2,3,6,7,10,11-hexacarbonitrile |
| SMILES | Cc1c(C#N)c(C#N)nc2c3nc(C#N)c(C#N)nc3c3cc(C#N)c(C#N)nc3c12 |
| InChI | InChI=1S/C21H4N10/c1-9-12(4-23)14(6-25)29-20-17(9)18-11(2-10(3-22)13(5-24)28-18)19-21(20)31-16(8-27)15(7-26)30-19/h2H,1H3 |
| InChIKey | ADVABKHZQISWLX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 194.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|