C19H7N9 — CID 130343710
7,11-diaminopyrido[2,3-f][1,10]phenanthroline-2,3,6,10-tetracarbonitrile (PubChem CID 130343710) has the molecular formula C19H7N9 and a molecular weight of 361.33 g/mol. Its IUPAC name is 7,11-diaminopyrido[2,3-f][1,10]phenanthroline-2,3,6,10-tetracarbonitrile.
| Compound Name | 7,11-diaminopyrido[2,3-f][1,10]phenanthroline-2,3,6,10-tetracarbonitrile |
|---|---|
| PubChem CID | 130343710 |
| Molecular Formula | C19H7N9 |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 7,11-diaminopyrido[2,3-f][1,10]phenanthroline-2,3,6,10-tetracarbonitrile |
| SMILES | N#Cc1cc2c3cc(N)c(C#N)nc3c3cc(C#N)c(C#N)nc3c2nc1N |
| InChI | InChI=1S/C19H7N9/c20-4-8-1-12-16-11(3-13(24)15(7-23)27-16)10-2-9(5-21)19(25)28-17(10)18(12)26-14(8)6-22/h1-3H,24H2,(H2,25,28) |
| InChIKey | JXKJTNVIJVEINM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 185.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|