About 6-amino-1H-pyrazolo[3,4-b]pyridine-5-carbonitrile
6-amino-1H-pyrazolo[3,4-b]pyridine-5-carbonitrile (PubChem CID 82415695) has the molecular formula C7H5N5
and a molecular weight of 159.15 g/mol. Its IUPAC name is 6-amino-1H-pyrazolo[3,4-b]pyridine-5-carbonitrile.
Analyze 6-amino-1H-pyrazolo[3,4-b]pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1H-pyrazolo[3,4-b]pyridine-5-carbonitrile?
The IUPAC name of 6-amino-1H-pyrazolo[3,4-b]pyridine-5-carbonitrile (CID 82415695) is 6-amino-1H-pyrazolo[3,4-b]pyridine-5-carbonitrile.
What is the SMILES notation for 6-amino-1H-pyrazolo[3,4-b]pyridine-5-carbonitrile?
The canonical SMILES for 6-amino-1H-pyrazolo[3,4-b]pyridine-5-carbonitrile is N#Cc1cc2cn[nH]c2nc1N.
What is the InChIKey of 6-amino-1H-pyrazolo[3,4-b]pyridine-5-carbonitrile?
The InChIKey is LPZPLAUSNGTUMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N5/c8-2-4-1-5-3-10-12-7(5)11-6(4)9/h1,3H,(H3,9,10,11,12).
What are the key properties of 6-amino-1H-pyrazolo[3,4-b]pyridine-5-carbonitrile?
6-amino-1H-pyrazolo[3,4-b]pyridine-5-carbonitrile has a molecular weight of 159.15 g/mol, XLogP of 0.41, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1H-pyrazolo[3,4-b]pyridine-5-carbonitrile is sourced from PubChem (CID 82415695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).