C18H5N11 — CID 87199494
11,16,17-triisocyano-5-methyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,8,10,12,15,17-octaene-4,10-dicarbonitrile (PubChem CID 87199494) has the molecular formula C18H5N11 and a molecular weight of 375.32 g/mol. Its IUPAC name is 11,16,17-triisocyano-5-methyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,8,10,12,15,17-octaene-4,10-dicarbonitrile.
| Compound Name | 11,16,17-triisocyano-5-methyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,8,10,12,15,17-octaene-4,10-dicarbonitrile |
|---|---|
| PubChem CID | 87199494 |
| Molecular Formula | C18H5N11 |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 11,16,17-triisocyano-5-methyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,8,10,12,15,17-octaene-4,10-dicarbonitrile |
| SMILES | [C-]#[N+]c1nc2c(nc1C#N)c1c(c3nc([N+]#[C-])c([N+]#[C-])nc32)N=C(C#N)C(C)N1 |
| InChI | InChI=1S/C18H5N11/c1-7-8(5-19)25-11-10(24-7)12-13(27-16(21-2)9(6-20)26-12)15-14(11)28-17(22-3)18(23-4)29-15/h7,24H,1H3 |
| InChIKey | HAENGAKZUKIRES-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 136.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|