C19H3N11 — CID 163593865
3,6,9,12,15-pentazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15-octaene-4,5,10,11,16,17-hexacarbonitrile (PubChem CID 163593865) has the molecular formula C19H3N11 and a molecular weight of 385.31 g/mol. Its IUPAC name is 3,6,9,12,15-pentazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15-octaene-4,5,10,11,16,17-hexacarbonitrile.
| Compound Name | 3,6,9,12,15-pentazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15-octaene-4,5,10,11,16,17-hexacarbonitrile |
|---|---|
| PubChem CID | 163593865 |
| Molecular Formula | C19H3N11 |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 3,6,9,12,15-pentazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15-octaene-4,5,10,11,16,17-hexacarbonitrile |
| SMILES | N#CC1=Nc2c(c3nc(C#N)c(C#N)nc3c3nc(C#N)c(C#N)nc23)CC1C#N |
| InChI | InChI=1S/C19H3N11/c20-2-8-1-9-15(26-10(8)3-21)17-19(30-14(7-25)13(6-24)29-17)18-16(9)27-11(4-22)12(5-23)28-18/h8H,1H2 |
| InChIKey | GRTSIWIYIKJIKD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 206.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|