C16H2N10 — CID 123686965
4-isocyano-3,5,9,11,16,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-6,10,17-tricarbonitrile (PubChem CID 123686965) has the molecular formula C16H2N10 and a molecular weight of 334.26 g/mol. Its IUPAC name is 4-isocyano-3,5,9,11,16,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-6,10,17-tricarbonitrile.
| Compound Name | 4-isocyano-3,5,9,11,16,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-6,10,17-tricarbonitrile |
|---|---|
| PubChem CID | 123686965 |
| Molecular Formula | C16H2N10 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 4-isocyano-3,5,9,11,16,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-6,10,17-tricarbonitrile |
| SMILES | [C-]#[N+]c1nc(C#N)c2c3nc(C#N)ncc3c3cnc(C#N)nc3c2n1 |
| InChI | InChI=1S/C16H2N10/c1-20-16-23-9(2-17)12-13-7(5-21-10(3-18)24-13)8-6-22-11(4-19)25-14(8)15(12)26-16/h5-6H |
| InChIKey | HUEPIGHQLVVRJP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 153.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|