C7H8F2N2 — CID 163298620
2,3-difluoro-5-propan-2-ylpyrazine (PubChem CID 163298620) has the molecular formula C7H8F2N2 and a molecular weight of 158.15 g/mol. Its IUPAC name is 2,3-difluoro-5-propan-2-ylpyrazine.
| Compound Name | 2,3-difluoro-5-propan-2-ylpyrazine |
|---|---|
| PubChem CID | 163298620 |
| Molecular Formula | C7H8F2N2 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 2,3-difluoro-5-propan-2-ylpyrazine |
| SMILES | CC(C)c1cnc(F)c(F)n1 |
| InChI | InChI=1S/C7H8F2N2/c1-4(2)5-3-10-6(8)7(9)11-5/h3-4H,1-2H3 |
| InChIKey | RCKXBPWFENNDDG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |