C6H8BrN3 — CID 105454049
3-bromo-5-propan-2-yl-1,2,4-triazine (PubChem CID 105454049) has the molecular formula C6H8BrN3 and a molecular weight of 202.06 g/mol. Its IUPAC name is 3-bromo-5-propan-2-yl-1,2,4-triazine.
| Compound Name | 3-bromo-5-propan-2-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 105454049 |
| Molecular Formula | C6H8BrN3 |
| Molecular Weight | 202.06 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 3-bromo-5-propan-2-yl-1,2,4-triazine |
| SMILES | CC(C)c1cnnc(Br)n1 |
| InChI | InChI=1S/C6H8BrN3/c1-4(2)5-3-8-10-6(7)9-5/h3-4H,1-2H3 |
| InChIKey | SGPOLQCYDWSIHN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.06 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |