C5H4ClF2N3 — CID 22284051
5-chloro-2,6-difluoropyridine-3,4-diamine (PubChem CID 22284051) has the molecular formula C5H4ClF2N3 and a molecular weight of 179.56 g/mol. Its IUPAC name is 5-chloro-2,6-difluoropyridine-3,4-diamine.
| Compound Name | 5-chloro-2,6-difluoropyridine-3,4-diamine |
|---|---|
| PubChem CID | 22284051 |
| Molecular Formula | C5H4ClF2N3 |
| Molecular Weight | 179.56 g/mol |
| Exact Mass | 179.01 |
| IUPAC Name | 5-chloro-2,6-difluoropyridine-3,4-diamine |
| SMILES | Nc1c(F)nc(F)c(Cl)c1N |
| InChI | InChI=1S/C5H4ClF2N3/c6-1-2(9)3(10)5(8)11-4(1)7/h10H2,(H2,9,11) |
| InChIKey | HTINXZSKCFWOIM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.56 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|