C9H9Cl2FN2O3 — CID 171060276
(3R)-3-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]butanoic acid (PubChem CID 171060276) has the molecular formula C9H9Cl2FN2O3 and a molecular weight of 283.09 g/mol. Its IUPAC name is (3R)-3-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]butanoic acid.
| Compound Name | (3R)-3-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]butanoic acid |
|---|---|
| PubChem CID | 171060276 |
| Molecular Formula | C9H9Cl2FN2O3 |
| Molecular Weight | 283.09 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | (3R)-3-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]butanoic acid |
| SMILES | C[C@H](CC(=O)O)Oc1nc(F)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C9H9Cl2FN2O3/c1-3(2-4(15)16)17-9-6(11)7(13)5(10)8(12)14-9/h3H,2H2,1H3,(H2,13,14)(H,15,16)/t3-/m1/s1 |
| InChIKey | OMLCSNLPVGYHCT-GSVOUGTGSA-N |
| XLogP | 2.35 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.09 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|