C15H13Cl2FN2O2S — CID 167082555
S-[(4-methylphenyl)methyl] 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]ethanethioate (PubChem CID 167082555) has the molecular formula C15H13Cl2FN2O2S and a molecular weight of 375.25 g/mol. Its IUPAC name is S-[(4-methylphenyl)methyl] 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]ethanethioate.
| Compound Name | S-[(4-methylphenyl)methyl] 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]ethanethioate |
|---|---|
| PubChem CID | 167082555 |
| Molecular Formula | C15H13Cl2FN2O2S |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | S-[(4-methylphenyl)methyl] 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]ethanethioate |
| SMILES | Cc1ccc(CSC(=O)COc2nc(F)c(Cl)c(N)c2Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2FN2O2S/c1-8-2-4-9(5-3-8)7-23-10(21)6-22-15-12(17)13(19)11(16)14(18)20-15/h2-5H,6-7H2,1H3,(H2,19,20) |
| InChIKey | PFNFFVOGGGMAOZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|