C13H10Cl2FN3O2S — CID 167082673
S-(pyridin-4-ylmethyl) 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]ethanethioate (PubChem CID 167082673) has the molecular formula C13H10Cl2FN3O2S and a molecular weight of 362.21 g/mol. Its IUPAC name is S-(pyridin-4-ylmethyl) 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]ethanethioate.
| Compound Name | S-(pyridin-4-ylmethyl) 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]ethanethioate |
|---|---|
| PubChem CID | 167082673 |
| Molecular Formula | C13H10Cl2FN3O2S |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | S-(pyridin-4-ylmethyl) 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]ethanethioate |
| SMILES | Nc1c(Cl)c(F)nc(OCC(=O)SCc2ccncc2)c1Cl |
| InChI | InChI=1S/C13H10Cl2FN3O2S/c14-9-11(17)10(15)13(19-12(9)16)21-5-8(20)22-6-7-1-3-18-4-2-7/h1-4H,5-6H2,(H2,17,19) |
| InChIKey | AYPZZMJJTHWGIH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|