C22H15Cl2F4N3O4 — CID 167082553
[2-oxo-2-(N-[4-(trifluoromethyl)phenyl]anilino)ethyl] 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate (PubChem CID 167082553) has the molecular formula C22H15Cl2F4N3O4 and a molecular weight of 532.28 g/mol. Its IUPAC name is [2-oxo-2-(N-[4-(trifluoromethyl)phenyl]anilino)ethyl] 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate.
| Compound Name | [2-oxo-2-(N-[4-(trifluoromethyl)phenyl]anilino)ethyl] 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
|---|---|
| PubChem CID | 167082553 |
| Molecular Formula | C22H15Cl2F4N3O4 |
| Molecular Weight | 532.28 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | [2-oxo-2-(N-[4-(trifluoromethyl)phenyl]anilino)ethyl] 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
| SMILES | Nc1c(Cl)c(F)nc(OCC(=O)OCC(=O)N(c2ccccc2)c2ccc(C(F)(F)F)cc2)c1Cl |
| InChI | InChI=1S/C22H15Cl2F4N3O4/c23-17-19(29)18(24)21(30-20(17)25)35-11-16(33)34-10-15(32)31(13-4-2-1-3-5-13)14-8-6-12(7-9-14)22(26,27)28/h1-9H,10-11H2,(H2,29,30) |
| InChIKey | CRLQADHOYFFBIH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.28 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|