C10H11Cl2FN2O3 — CID 169440678
1,1,1,2,3,3,3-heptadeuteriopropan-2-yl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate (PubChem CID 169440678) has the molecular formula C10H11Cl2FN2O3 and a molecular weight of 304.16 g/mol. Its IUPAC name is 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate.
| Compound Name | 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
|---|---|
| PubChem CID | 169440678 |
| Molecular Formula | C10H11Cl2FN2O3 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
| SMILES | [2H]C([2H])([2H])C([2H])(OC(=O)COc1nc(F)c(Cl)c(N)c1Cl)C([2H])([2H])[2H] |
| InChI | InChI=1S/C10H11Cl2FN2O3/c1-4(2)18-5(16)3-17-10-7(12)8(14)6(11)9(13)15-10/h4H,3H2,1-2H3,(H2,14,15)/i1D3,2D3,4D |
| InChIKey | GAJOTJVVTDVNQA-UAVYNJCWSA-N |
| XLogP | 2.44 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|