C10H9Cl2F3N2O3 — CID 164930241
2,2-difluoroethyl (2R)-2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]propanoate (PubChem CID 164930241) has the molecular formula C10H9Cl2F3N2O3 and a molecular weight of 333.09 g/mol. Its IUPAC name is 2,2-difluoroethyl (2R)-2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]propanoate.
| Compound Name | 2,2-difluoroethyl (2R)-2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]propanoate |
|---|---|
| PubChem CID | 164930241 |
| Molecular Formula | C10H9Cl2F3N2O3 |
| Molecular Weight | 333.09 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 2,2-difluoroethyl (2R)-2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]propanoate |
| SMILES | C[C@@H](Oc1nc(F)c(Cl)c(N)c1Cl)C(=O)OCC(F)F |
| InChI | InChI=1S/C10H9Cl2F3N2O3/c1-3(10(18)19-2-4(13)14)20-9-6(12)7(16)5(11)8(15)17-9/h3-4H,2H2,1H3,(H2,16,17)/t3-/m1/s1 |
| InChIKey | XAIHRNLQMBTXMA-GSVOUGTGSA-N |
| XLogP | 2.69 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.09 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|