C11H13Cl2FN2O3 — CID 167082543
2-methylpropyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate (PubChem CID 167082543) has the molecular formula C11H13Cl2FN2O3 and a molecular weight of 311.14 g/mol. Its IUPAC name is 2-methylpropyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate.
| Compound Name | 2-methylpropyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
|---|---|
| PubChem CID | 167082543 |
| Molecular Formula | C11H13Cl2FN2O3 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 2-methylpropyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
| SMILES | CC(C)COC(=O)COc1nc(F)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C11H13Cl2FN2O3/c1-5(2)3-18-6(17)4-19-11-8(13)9(15)7(12)10(14)16-11/h5H,3-4H2,1-2H3,(H2,15,16) |
| InChIKey | OEDFZUQYJHMNRE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|