C14H10BrCl2FN2O3 — CID 167082577
(3-bromophenyl)methyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate (PubChem CID 167082577) has the molecular formula C14H10BrCl2FN2O3 and a molecular weight of 424.05 g/mol. Its IUPAC name is (3-bromophenyl)methyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate.
| Compound Name | (3-bromophenyl)methyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
|---|---|
| PubChem CID | 167082577 |
| Molecular Formula | C14H10BrCl2FN2O3 |
| Molecular Weight | 424.05 g/mol |
| Exact Mass | 421.92 |
| IUPAC Name | (3-bromophenyl)methyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
| SMILES | Nc1c(Cl)c(F)nc(OCC(=O)OCc2cccc(Br)c2)c1Cl |
| InChI | InChI=1S/C14H10BrCl2FN2O3/c15-8-3-1-2-7(4-8)5-22-9(21)6-23-14-11(17)12(19)10(16)13(18)20-14/h1-4H,5-6H2,(H2,19,20) |
| InChIKey | NJJFARUIUCZHKU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.05 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|