C15H13Cl2FN2O3 — CID 167082625
(3-methylphenyl)methyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate (PubChem CID 167082625) has the molecular formula C15H13Cl2FN2O3 and a molecular weight of 359.18 g/mol. Its IUPAC name is (3-methylphenyl)methyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate.
| Compound Name | (3-methylphenyl)methyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
|---|---|
| PubChem CID | 167082625 |
| Molecular Formula | C15H13Cl2FN2O3 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | (3-methylphenyl)methyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
| SMILES | Cc1cccc(COC(=O)COc2nc(F)c(Cl)c(N)c2Cl)c1 |
| InChI | InChI=1S/C15H13Cl2FN2O3/c1-8-3-2-4-9(5-8)6-22-10(21)7-23-15-12(17)13(19)11(16)14(18)20-15/h2-5H,6-7H2,1H3,(H2,19,20) |
| InChIKey | YARCSCJQUGWCOZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|