C20H14Cl2FN3O3 — CID 167082661
(benzhydrylideneamino) 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate (PubChem CID 167082661) has the molecular formula C20H14Cl2FN3O3 and a molecular weight of 434.25 g/mol. Its IUPAC name is (benzhydrylideneamino) 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate.
| Compound Name | (benzhydrylideneamino) 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
|---|---|
| PubChem CID | 167082661 |
| Molecular Formula | C20H14Cl2FN3O3 |
| Molecular Weight | 434.25 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | (benzhydrylideneamino) 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
| SMILES | Nc1c(Cl)c(F)nc(OCC(=O)ON=C(c2ccccc2)c2ccccc2)c1Cl |
| InChI | InChI=1S/C20H14Cl2FN3O3/c21-15-17(24)16(22)20(25-19(15)23)28-11-14(27)29-26-18(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2,(H2,24,25) |
| InChIKey | MJVFMENTUKWTNG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.25 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|