About pyridin-4-ylmethyl 3-amino-2-chlorobenzoate
pyridin-4-ylmethyl 3-amino-2-chlorobenzoate (PubChem CID 112580450) has the molecular formula C13H11ClN2O2
and a molecular weight of 262.70 g/mol. Its IUPAC name is pyridin-4-ylmethyl 3-amino-2-chlorobenzoate.
Molecular Properties
| Compound Name | pyridin-4-ylmethyl 3-amino-2-chlorobenzoate |
| PubChem CID | 112580450 |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | pyridin-4-ylmethyl 3-amino-2-chlorobenzoate |
| SMILES | Nc1cccc(C(=O)OCc2ccncc2)c1Cl |
| InChI | InChI=1S/C13H11ClN2O2/c14-12-10(2-1-3-11(12)15)13(17)18-8-9-4-6-16-7-5-9/h1-7H,8,15H2 |
| InChIKey | GRXWRFFXLRCPKK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze pyridin-4-ylmethyl 3-amino-2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-4-ylmethyl 3-amino-2-chlorobenzoate?
The IUPAC name of pyridin-4-ylmethyl 3-amino-2-chlorobenzoate (CID 112580450) is pyridin-4-ylmethyl 3-amino-2-chlorobenzoate.
What is the SMILES notation for pyridin-4-ylmethyl 3-amino-2-chlorobenzoate?
The canonical SMILES for pyridin-4-ylmethyl 3-amino-2-chlorobenzoate is Nc1cccc(C(=O)OCc2ccncc2)c1Cl.
What is the InChIKey of pyridin-4-ylmethyl 3-amino-2-chlorobenzoate?
The InChIKey is GRXWRFFXLRCPKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN2O2/c14-12-10(2-1-3-11(12)15)13(17)18-8-9-4-6-16-7-5-9/h1-7H,8,15H2.
What are the key properties of pyridin-4-ylmethyl 3-amino-2-chlorobenzoate?
pyridin-4-ylmethyl 3-amino-2-chlorobenzoate has a molecular weight of 262.70 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-4-ylmethyl 3-amino-2-chlorobenzoate is sourced from PubChem (CID 112580450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).