(1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate

C15H18ClN3O2 — CID 115936069

IUPAC(1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate
SMILESCCc1cc(COC(=O)c2cccc(N)c2Cl)n(CC)n1
InChIInChI=1S/C15H18ClN3O2/c1-3-10-8-11(19(4-2)18-10)9-21-15(20)12-6-5-7-13(17)14(12)16/h5-8H,3-4,9,17H2,1-2H3
InChIKeyIEFAHIIQFWWWRA-UHFFFAOYSA-N
MW307.78 g/mol
LogP3.06
Rot. Bonds5

About (1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate

(1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate (PubChem CID 115936069) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is (1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate.

Molecular Properties

Compound Name(1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate
PubChem CID115936069
Molecular FormulaC15H18ClN3O2
Molecular Weight307.78 g/mol
Exact Mass307.11
IUPAC Name(1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate
SMILESCCc1cc(COC(=O)c2cccc(N)c2Cl)n(CC)n1
InChIInChI=1S/C15H18ClN3O2/c1-3-10-8-11(19(4-2)18-10)9-21-15(20)12-6-5-7-13(17)14(12)16/h5-8H,3-4,9,17H2,1-2H3
InChIKeyIEFAHIIQFWWWRA-UHFFFAOYSA-N
XLogP3.06
TPSA70.14 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.78
LogP ≤ 53.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze (1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate?
The IUPAC name of (1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate (CID 115936069) is (1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate.
What is the SMILES notation for (1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate?
The canonical SMILES for (1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate is CCc1cc(COC(=O)c2cccc(N)c2Cl)n(CC)n1.
What is the InChIKey of (1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate?
The InChIKey is IEFAHIIQFWWWRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3O2/c1-3-10-8-11(19(4-2)18-10)9-21-15(20)12-6-5-7-13(17)14(12)16/h5-8H,3-4,9,17H2,1-2H3.
What are the key properties of (1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate?
(1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate has a molecular weight of 307.78 g/mol, XLogP of 3.06, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-diethylpyrazol-5-yl)methyl 3-amino-2-chlorobenzoate is sourced from PubChem (CID 115936069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).