About (2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate
(2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate (PubChem CID 115936068) has the molecular formula C14H16ClN3O2
and a molecular weight of 293.75 g/mol. Its IUPAC name is (2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate.
Molecular Properties
| Compound Name | (2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate |
| PubChem CID | 115936068 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate |
| SMILES | CCn1nc(C)cc1COC(=O)c1cccc(N)c1Cl |
| InChI | InChI=1S/C14H16ClN3O2/c1-3-18-10(7-9(2)17-18)8-20-14(19)11-5-4-6-12(16)13(11)15/h4-7H,3,8,16H2,1-2H3 |
| InChIKey | JDUDPDZENNMAOW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate?
The IUPAC name of (2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate (CID 115936068) is (2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate.
What is the SMILES notation for (2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate?
The canonical SMILES for (2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate is CCn1nc(C)cc1COC(=O)c1cccc(N)c1Cl.
What is the InChIKey of (2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate?
The InChIKey is JDUDPDZENNMAOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN3O2/c1-3-18-10(7-9(2)17-18)8-20-14(19)11-5-4-6-12(16)13(11)15/h4-7H,3,8,16H2,1-2H3.
What are the key properties of (2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate?
(2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate has a molecular weight of 293.75 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-5-methylpyrazol-3-yl)methyl 3-amino-2-chlorobenzoate is sourced from PubChem (CID 115936068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).