C16H16ClNO2 — CID 115936083
(3,5-dimethylphenyl)methyl 3-amino-2-chlorobenzoate (PubChem CID 115936083) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is (3,5-dimethylphenyl)methyl 3-amino-2-chlorobenzoate.
| Compound Name | (3,5-dimethylphenyl)methyl 3-amino-2-chlorobenzoate |
|---|---|
| PubChem CID | 115936083 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (3,5-dimethylphenyl)methyl 3-amino-2-chlorobenzoate |
| SMILES | Cc1cc(C)cc(COC(=O)c2cccc(N)c2Cl)c1 |
| InChI | InChI=1S/C16H16ClNO2/c1-10-6-11(2)8-12(7-10)9-20-16(19)13-4-3-5-14(18)15(13)17/h3-8H,9,18H2,1-2H3 |
| InChIKey | PYQZRIFIHIBGAL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|