C15H19N3O3 — CID 107341422
2-amino-6-[(1,3-diethylpyrazol-5-yl)methoxy]benzoic acid (PubChem CID 107341422) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-amino-6-[(1,3-diethylpyrazol-5-yl)methoxy]benzoic acid.
| Compound Name | 2-amino-6-[(1,3-diethylpyrazol-5-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 107341422 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-amino-6-[(1,3-diethylpyrazol-5-yl)methoxy]benzoic acid |
| SMILES | CCc1cc(COc2cccc(N)c2C(=O)O)n(CC)n1 |
| InChI | InChI=1S/C15H19N3O3/c1-3-10-8-11(18(4-2)17-10)9-21-13-7-5-6-12(16)14(13)15(19)20/h5-8H,3-4,9,16H2,1-2H3,(H,19,20) |
| InChIKey | LGLFSRDDTMERQF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|