C19H15N3O4 — CID 101348093
bis(pyridin-4-ylmethyl) pyridine-2,6-dicarboxylate (PubChem CID 101348093) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is bis(pyridin-4-ylmethyl) pyridine-2,6-dicarboxylate.
| Compound Name | bis(pyridin-4-ylmethyl) pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 101348093 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | bis(pyridin-4-ylmethyl) pyridine-2,6-dicarboxylate |
| SMILES | O=C(OCc1ccncc1)c1cccc(C(=O)OCc2ccncc2)n1 |
| InChI | InChI=1S/C19H15N3O4/c23-18(25-12-14-4-8-20-9-5-14)16-2-1-3-17(22-16)19(24)26-13-15-6-10-21-11-7-15/h1-11H,12-13H2 |
| InChIKey | QVCOVURSDGBJJN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 91.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |