About 1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate
1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate (PubChem CID 161397349) has the molecular formula C18H21ClOS
and a molecular weight of 320.89 g/mol. Its IUPAC name is 1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate.
Molecular Properties
| Compound Name | 1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate |
| PubChem CID | 161397349 |
| Molecular Formula | C18H21ClOS |
| Molecular Weight | 320.89 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate |
| SMILES | CC(=O)SCc1ccc(C)cc1.Cc1ccc(CCl)cc1 |
| InChI | InChI=1S/C10H12OS.C8H9Cl/c1-8-3-5-10(6-4-8)7-12-9(2)11;1-7-2-4-8(6-9)5-3-7/h3-6H,7H2,1-2H3;2-5H,6H2,1H3 |
| InChIKey | VTTWGGHRHGSFPE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.89 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate?
The IUPAC name of 1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate (CID 161397349) is 1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate.
What is the SMILES notation for 1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate?
The canonical SMILES for 1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate is CC(=O)SCc1ccc(C)cc1.Cc1ccc(CCl)cc1.
What is the InChIKey of 1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate?
The InChIKey is VTTWGGHRHGSFPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS.C8H9Cl/c1-8-3-5-10(6-4-8)7-12-9(2)11;1-7-2-4-8(6-9)5-3-7/h3-6H,7H2,1-2H3;2-5H,6H2,1H3.
What are the key properties of 1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate?
1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate has a molecular weight of 320.89 g/mol, XLogP of 5.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(chloromethyl)-4-methylbenzene;S-[(4-methylphenyl)methyl] ethanethioate is sourced from PubChem (CID 161397349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).