About S-benzyl ethanethioate;propanoic acid
S-benzyl ethanethioate;propanoic acid (PubChem CID 157378732) has the molecular formula C12H16O3S
and a molecular weight of 240.32 g/mol. Its IUPAC name is S-benzyl ethanethioate;propanoic acid.
Molecular Properties
| Compound Name | S-benzyl ethanethioate;propanoic acid |
| PubChem CID | 157378732 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | S-benzyl ethanethioate;propanoic acid |
| SMILES | CC(=O)SCc1ccccc1.CCC(=O)O |
| InChI | InChI=1S/C9H10OS.C3H6O2/c1-8(10)11-7-9-5-3-2-4-6-9;1-2-3(4)5/h2-6H,7H2,1H3;2H2,1H3,(H,4,5) |
| InChIKey | BKPXLBGIIFNCLR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-benzyl ethanethioate;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-benzyl ethanethioate;propanoic acid?
The IUPAC name of S-benzyl ethanethioate;propanoic acid (CID 157378732) is S-benzyl ethanethioate;propanoic acid.
What is the SMILES notation for S-benzyl ethanethioate;propanoic acid?
The canonical SMILES for S-benzyl ethanethioate;propanoic acid is CC(=O)SCc1ccccc1.CCC(=O)O.
What is the InChIKey of S-benzyl ethanethioate;propanoic acid?
The InChIKey is BKPXLBGIIFNCLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10OS.C3H6O2/c1-8(10)11-7-9-5-3-2-4-6-9;1-2-3(4)5/h2-6H,7H2,1H3;2H2,1H3,(H,4,5).
What are the key properties of S-benzyl ethanethioate;propanoic acid?
S-benzyl ethanethioate;propanoic acid has a molecular weight of 240.32 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-benzyl ethanethioate;propanoic acid is sourced from PubChem (CID 157378732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).