C16H16OS2 — CID 101355030
S-[[4-[4-(sulfanylmethyl)phenyl]phenyl]methyl] ethanethioate (PubChem CID 101355030) has the molecular formula C16H16OS2 and a molecular weight of 288.44 g/mol. Its IUPAC name is S-[[4-[4-(sulfanylmethyl)phenyl]phenyl]methyl] ethanethioate.
| Compound Name | S-[[4-[4-(sulfanylmethyl)phenyl]phenyl]methyl] ethanethioate |
|---|---|
| PubChem CID | 101355030 |
| Molecular Formula | C16H16OS2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | S-[[4-[4-(sulfanylmethyl)phenyl]phenyl]methyl] ethanethioate |
| SMILES | CC(=O)SCc1ccc(-c2ccc(CS)cc2)cc1 |
| InChI | InChI=1S/C16H16OS2/c1-12(17)19-11-14-4-8-16(9-5-14)15-6-2-13(10-18)3-7-15/h2-9,18H,10-11H2,1H3 |
| InChIKey | RBASQWIBUNVWNT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|