C24H20F2O2S2 — CID 24751550
S-[[3-(acetylsulfanylmethyl)-5-[4-(3,5-difluorophenyl)phenyl]phenyl]methyl] ethanethioate (PubChem CID 24751550) has the molecular formula C24H20F2O2S2 and a molecular weight of 442.55 g/mol. Its IUPAC name is S-[[3-(acetylsulfanylmethyl)-5-[4-(3,5-difluorophenyl)phenyl]phenyl]methyl] ethanethioate.
| Compound Name | S-[[3-(acetylsulfanylmethyl)-5-[4-(3,5-difluorophenyl)phenyl]phenyl]methyl] ethanethioate |
|---|---|
| PubChem CID | 24751550 |
| Molecular Formula | C24H20F2O2S2 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | S-[[3-(acetylsulfanylmethyl)-5-[4-(3,5-difluorophenyl)phenyl]phenyl]methyl] ethanethioate |
| SMILES | CC(=O)SCc1cc(CSC(C)=O)cc(-c2ccc(-c3cc(F)cc(F)c3)cc2)c1 |
| InChI | InChI=1S/C24H20F2O2S2/c1-15(27)29-13-17-7-18(14-30-16(2)28)9-21(8-17)19-3-5-20(6-4-19)22-10-23(25)12-24(26)11-22/h3-12H,13-14H2,1-2H3 |
| InChIKey | NUVAGRXAYIHDSZ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|