C21H32O2S — CID 158504557
S-[[4-(9,9-dimethyl-3-oxodecyl)phenyl]methyl] ethanethioate (PubChem CID 158504557) has the molecular formula C21H32O2S and a molecular weight of 348.55 g/mol. Its IUPAC name is S-[[4-(9,9-dimethyl-3-oxodecyl)phenyl]methyl] ethanethioate.
| Compound Name | S-[[4-(9,9-dimethyl-3-oxodecyl)phenyl]methyl] ethanethioate |
|---|---|
| PubChem CID | 158504557 |
| Molecular Formula | C21H32O2S |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | S-[[4-(9,9-dimethyl-3-oxodecyl)phenyl]methyl] ethanethioate |
| SMILES | CC(=O)SCc1ccc(CCC(=O)CCCCCC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H32O2S/c1-17(22)24-16-19-11-9-18(10-12-19)13-14-20(23)8-6-5-7-15-21(2,3)4/h9-12H,5-8,13-16H2,1-4H3 |
| InChIKey | FPJMXIAHLLDQIK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|