C9H5Cl3F2N2O — CID 168688905
4-chloro-1-(3,5-dichloro-2,6-difluoro-4-pyridinyl)pyrrolidin-2-one (PubChem CID 168688905) has the molecular formula C9H5Cl3F2N2O and a molecular weight of 301.51 g/mol. Its IUPAC name is 4-chloro-1-(3,5-dichloro-2,6-difluoro-4-pyridinyl)pyrrolidin-2-one.
| Compound Name | 4-chloro-1-(3,5-dichloro-2,6-difluoro-4-pyridinyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168688905 |
| Molecular Formula | C9H5Cl3F2N2O |
| Molecular Weight | 301.51 g/mol |
| Exact Mass | 299.94 |
| IUPAC Name | 4-chloro-1-(3,5-dichloro-2,6-difluoro-4-pyridinyl)pyrrolidin-2-one |
| SMILES | O=C1CC(Cl)CN1c1c(Cl)c(F)nc(F)c1Cl |
| InChI | InChI=1S/C9H5Cl3F2N2O/c10-3-1-4(17)16(2-3)7-5(11)8(13)15-9(14)6(7)12/h3H,1-2H2 |
| InChIKey | WATIGGFHHSIOFO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|