C8H6Cl3N3O — CID 168689444
4-chloro-1-(2,4-dichloropyrimidin-5-yl)pyrrolidin-2-one (PubChem CID 168689444) has the molecular formula C8H6Cl3N3O and a molecular weight of 266.51 g/mol. Its IUPAC name is 4-chloro-1-(2,4-dichloropyrimidin-5-yl)pyrrolidin-2-one.
| Compound Name | 4-chloro-1-(2,4-dichloropyrimidin-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168689444 |
| Molecular Formula | C8H6Cl3N3O |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 264.96 |
| IUPAC Name | 4-chloro-1-(2,4-dichloropyrimidin-5-yl)pyrrolidin-2-one |
| SMILES | O=C1CC(Cl)CN1c1cnc(Cl)nc1Cl |
| InChI | InChI=1S/C8H6Cl3N3O/c9-4-1-6(15)14(3-4)5-2-12-8(11)13-7(5)10/h2,4H,1,3H2 |
| InChIKey | HFYRGBUGPMDOEH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|