C10H6Cl3F2NO — CID 168689041
4-chloro-1-(3,5-dichloro-2,4-difluorophenyl)pyrrolidin-2-one (PubChem CID 168689041) has the molecular formula C10H6Cl3F2NO and a molecular weight of 300.52 g/mol. Its IUPAC name is 4-chloro-1-(3,5-dichloro-2,4-difluorophenyl)pyrrolidin-2-one.
| Compound Name | 4-chloro-1-(3,5-dichloro-2,4-difluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168689041 |
| Molecular Formula | C10H6Cl3F2NO |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 298.95 |
| IUPAC Name | 4-chloro-1-(3,5-dichloro-2,4-difluorophenyl)pyrrolidin-2-one |
| SMILES | O=C1CC(Cl)CN1c1cc(Cl)c(F)c(Cl)c1F |
| InChI | InChI=1S/C10H6Cl3F2NO/c11-4-1-7(17)16(3-4)6-2-5(12)9(14)8(13)10(6)15/h2,4H,1,3H2 |
| InChIKey | MTKQSHYJRDMZCX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|