C11H8Cl2F2N2O2 — CID 168697676
1-(3,5-dichloro-2,4-difluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 168697676) has the molecular formula C11H8Cl2F2N2O2 and a molecular weight of 309.10 g/mol. Its IUPAC name is 1-(3,5-dichloro-2,4-difluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3,5-dichloro-2,4-difluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168697676 |
| Molecular Formula | C11H8Cl2F2N2O2 |
| Molecular Weight | 309.10 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 1-(3,5-dichloro-2,4-difluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(c2cc(Cl)c(F)c(Cl)c2F)C1 |
| InChI | InChI=1S/C11H8Cl2F2N2O2/c12-5-2-6(10(15)8(13)9(5)14)17-3-4(11(16)19)1-7(17)18/h2,4H,1,3H2,(H2,16,19) |
| InChIKey | UYCMUUAWLHATSS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.10 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|