C10H9Cl3N2O — CID 168688969
1-(2-amino-4,5-dichlorophenyl)-4-chloropyrrolidin-2-one (PubChem CID 168688969) has the molecular formula C10H9Cl3N2O and a molecular weight of 279.55 g/mol. Its IUPAC name is 1-(2-amino-4,5-dichlorophenyl)-4-chloropyrrolidin-2-one.
| Compound Name | 1-(2-amino-4,5-dichlorophenyl)-4-chloropyrrolidin-2-one |
|---|---|
| PubChem CID | 168688969 |
| Molecular Formula | C10H9Cl3N2O |
| Molecular Weight | 279.55 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 1-(2-amino-4,5-dichlorophenyl)-4-chloropyrrolidin-2-one |
| SMILES | Nc1cc(Cl)c(Cl)cc1N1CC(Cl)CC1=O |
| InChI | InChI=1S/C10H9Cl3N2O/c11-5-1-10(16)15(4-5)9-3-7(13)6(12)2-8(9)14/h2-3,5H,1,4,14H2 |
| InChIKey | KDPAJGZCFDBXGS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|