C12H15ClN2O — CID 168688113
1-(2-amino-3,5-dimethylphenyl)-4-chloropyrrolidin-2-one (PubChem CID 168688113) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 1-(2-amino-3,5-dimethylphenyl)-4-chloropyrrolidin-2-one.
| Compound Name | 1-(2-amino-3,5-dimethylphenyl)-4-chloropyrrolidin-2-one |
|---|---|
| PubChem CID | 168688113 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1-(2-amino-3,5-dimethylphenyl)-4-chloropyrrolidin-2-one |
| SMILES | Cc1cc(C)c(N)c(N2CC(Cl)CC2=O)c1 |
| InChI | InChI=1S/C12H15ClN2O/c1-7-3-8(2)12(14)10(4-7)15-6-9(13)5-11(15)16/h3-4,9H,5-6,14H2,1-2H3 |
| InChIKey | XDLRZHPNBVYCLK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|