C10H8ClF2NO — CID 168689348
4-chloro-1-(2,4-difluorophenyl)pyrrolidin-2-one (PubChem CID 168689348) has the molecular formula C10H8ClF2NO and a molecular weight of 231.63 g/mol. Its IUPAC name is 4-chloro-1-(2,4-difluorophenyl)pyrrolidin-2-one.
| Compound Name | 4-chloro-1-(2,4-difluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168689348 |
| Molecular Formula | C10H8ClF2NO |
| Molecular Weight | 231.63 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 4-chloro-1-(2,4-difluorophenyl)pyrrolidin-2-one |
| SMILES | O=C1CC(Cl)CN1c1ccc(F)cc1F |
| InChI | InChI=1S/C10H8ClF2NO/c11-6-3-10(15)14(5-6)9-2-1-7(12)4-8(9)13/h1-2,4,6H,3,5H2 |
| InChIKey | OIMNBIBVGQUQRB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.63 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|