C11H10ClF2NO2 — CID 168687823
4-chloro-1-(2,6-difluoro-4-methoxyphenyl)pyrrolidin-2-one (PubChem CID 168687823) has the molecular formula C11H10ClF2NO2 and a molecular weight of 261.65 g/mol. Its IUPAC name is 4-chloro-1-(2,6-difluoro-4-methoxyphenyl)pyrrolidin-2-one.
| Compound Name | 4-chloro-1-(2,6-difluoro-4-methoxyphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168687823 |
| Molecular Formula | C11H10ClF2NO2 |
| Molecular Weight | 261.65 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 4-chloro-1-(2,6-difluoro-4-methoxyphenyl)pyrrolidin-2-one |
| SMILES | COc1cc(F)c(N2CC(Cl)CC2=O)c(F)c1 |
| InChI | InChI=1S/C11H10ClF2NO2/c1-17-7-3-8(13)11(9(14)4-7)15-5-6(12)2-10(15)16/h3-4,6H,2,5H2,1H3 |
| InChIKey | JRWISIBMLXOUFV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.65 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|