C10H14ClN3O — CID 168688173
4-chloro-1-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one (PubChem CID 168688173) has the molecular formula C10H14ClN3O and a molecular weight of 227.69 g/mol. Its IUPAC name is 4-chloro-1-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one.
| Compound Name | 4-chloro-1-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168688173 |
| Molecular Formula | C10H14ClN3O |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 4-chloro-1-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one |
| SMILES | Cc1nn(C)c(C)c1N1CC(Cl)CC1=O |
| InChI | InChI=1S/C10H14ClN3O/c1-6-10(7(2)13(3)12-6)14-5-8(11)4-9(14)15/h8H,4-5H2,1-3H3 |
| InChIKey | VJOYQXWUUKMRSO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|