C5Cl4F3N2O2P — CID 13086910
4,5-dichloro-2-dichlorophosphoryloxy-6-(trifluoromethyl)pyrimidine (PubChem CID 13086910) has the molecular formula C5Cl4F3N2O2P and a molecular weight of 349.85 g/mol. Its IUPAC name is 4,5-dichloro-2-dichlorophosphoryloxy-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4,5-dichloro-2-dichlorophosphoryloxy-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 13086910 |
| Molecular Formula | C5Cl4F3N2O2P |
| Molecular Weight | 349.85 g/mol |
| Exact Mass | 347.84 |
| IUPAC Name | 4,5-dichloro-2-dichlorophosphoryloxy-6-(trifluoromethyl)pyrimidine |
| SMILES | O=P(Cl)(Cl)Oc1nc(Cl)c(Cl)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C5Cl4F3N2O2P/c6-1-2(5(10,11)12)13-4(14-3(1)7)16-17(8,9)15 |
| InChIKey | VXFWZXUHRNTTDK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.85 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|