C6HBr2ClF3N — CID 124849965
3,5-dibromo-2-chloro-6-(trifluoromethyl)pyridine (PubChem CID 124849965) has the molecular formula C6HBr2ClF3N and a molecular weight of 339.34 g/mol. Its IUPAC name is 3,5-dibromo-2-chloro-6-(trifluoromethyl)pyridine.
| Compound Name | 3,5-dibromo-2-chloro-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 124849965 |
| Molecular Formula | C6HBr2ClF3N |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 336.81 |
| IUPAC Name | 3,5-dibromo-2-chloro-6-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1nc(Cl)c(Br)cc1Br |
| InChI | InChI=1S/C6HBr2ClF3N/c7-2-1-3(8)5(9)13-4(2)6(10,11)12/h1H |
| InChIKey | PTKXDSQYFCZKCA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|