C6H5Br2ClN2 — CID 118705082
3,5-dibromo-6-chloro-N-methylpyridin-2-amine (PubChem CID 118705082) has the molecular formula C6H5Br2ClN2 and a molecular weight of 300.38 g/mol. Its IUPAC name is 3,5-dibromo-6-chloro-N-methylpyridin-2-amine.
| Compound Name | 3,5-dibromo-6-chloro-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 118705082 |
| Molecular Formula | C6H5Br2ClN2 |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 297.85 |
| IUPAC Name | 3,5-dibromo-6-chloro-N-methylpyridin-2-amine |
| SMILES | CNc1nc(Cl)c(Br)cc1Br |
| InChI | InChI=1S/C6H5Br2ClN2/c1-10-6-4(8)2-3(7)5(9)11-6/h2H,1H3,(H,10,11) |
| InChIKey | WXQFDEPOKDSQLB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|