C4H4F6O4S2 — CID 141114696
1,2-bis(trifluoromethylsulfonyl)ethane (PubChem CID 141114696) has the molecular formula C4H4F6O4S2 and a molecular weight of 294.19 g/mol. Its IUPAC name is 1,2-bis(trifluoromethylsulfonyl)ethane.
| Compound Name | 1,2-bis(trifluoromethylsulfonyl)ethane |
|---|---|
| PubChem CID | 141114696 |
| Molecular Formula | C4H4F6O4S2 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | 1,2-bis(trifluoromethylsulfonyl)ethane |
| SMILES | O=S(=O)(CCS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H4F6O4S2/c5-3(6,7)15(11,12)1-2-16(13,14)4(8,9)10/h1-2H2 |
| InChIKey | OTZCLLWKPLMQTE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |