C7HF7N2O — CID 169302963
2,2,2-trifluoro-N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide (PubChem CID 169302963) has the molecular formula C7HF7N2O and a molecular weight of 262.08 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide |
|---|---|
| PubChem CID | 169302963 |
| Molecular Formula | C7HF7N2O |
| Molecular Weight | 262.08 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2,2,2-trifluoro-N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide |
| SMILES | O=C(Nc1c(F)c(F)nc(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C7HF7N2O/c8-1-3(15-6(17)7(12,13)14)2(9)5(11)16-4(1)10/h(H,15,16,17) |
| InChIKey | IWGQPBDIQWWHHY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.08 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|