C13H8F5NS — CID 133371906
2,3,5,6-tetrafluoro-4-[1-(2-fluorophenyl)ethylsulfanyl]pyridine (PubChem CID 133371906) has the molecular formula C13H8F5NS and a molecular weight of 305.27 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[1-(2-fluorophenyl)ethylsulfanyl]pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-[1-(2-fluorophenyl)ethylsulfanyl]pyridine |
|---|---|
| PubChem CID | 133371906 |
| Molecular Formula | C13H8F5NS |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[1-(2-fluorophenyl)ethylsulfanyl]pyridine |
| SMILES | CC(Sc1c(F)c(F)nc(F)c1F)c1ccccc1F |
| InChI | InChI=1S/C13H8F5NS/c1-6(7-4-2-3-5-8(7)14)20-11-9(15)12(17)19-13(18)10(11)16/h2-6H,1H3 |
| InChIKey | ORGIMNQLTJMXQI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|