About 1-[(2S)-1,1-difluoropropan-2-yl]-2-fluorobenzene
1-[(2S)-1,1-difluoropropan-2-yl]-2-fluorobenzene (PubChem CID 126565772) has the molecular formula C9H9F3
and a molecular weight of 174.16 g/mol. Its IUPAC name is 1-[(2S)-1,1-difluoropropan-2-yl]-2-fluorobenzene.
Analyze 1-[(2S)-1,1-difluoropropan-2-yl]-2-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-1,1-difluoropropan-2-yl]-2-fluorobenzene?
The IUPAC name of 1-[(2S)-1,1-difluoropropan-2-yl]-2-fluorobenzene (CID 126565772) is 1-[(2S)-1,1-difluoropropan-2-yl]-2-fluorobenzene.
What is the SMILES notation for 1-[(2S)-1,1-difluoropropan-2-yl]-2-fluorobenzene?
The canonical SMILES for 1-[(2S)-1,1-difluoropropan-2-yl]-2-fluorobenzene is C[C@@H](c1ccccc1F)C(F)F.
What is the InChIKey of 1-[(2S)-1,1-difluoropropan-2-yl]-2-fluorobenzene?
The InChIKey is FKFXQBLXRBJRFI-LURJTMIESA-N. The full InChI is InChI=1S/C9H9F3/c1-6(9(11)12)7-4-2-3-5-8(7)10/h2-6,9H,1H3/t6-/m0/s1.
What are the key properties of 1-[(2S)-1,1-difluoropropan-2-yl]-2-fluorobenzene?
1-[(2S)-1,1-difluoropropan-2-yl]-2-fluorobenzene has a molecular weight of 174.16 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-1,1-difluoropropan-2-yl]-2-fluorobenzene is sourced from PubChem (CID 126565772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).