C10H10F2O — CID 141407367
(2R,3R)-2-fluoro-3-(2-fluorophenyl)butanal (PubChem CID 141407367) has the molecular formula C10H10F2O and a molecular weight of 184.19 g/mol. Its IUPAC name is (2R,3R)-2-fluoro-3-(2-fluorophenyl)butanal.
| Compound Name | (2R,3R)-2-fluoro-3-(2-fluorophenyl)butanal |
|---|---|
| PubChem CID | 141407367 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (2R,3R)-2-fluoro-3-(2-fluorophenyl)butanal |
| SMILES | C[C@H](c1ccccc1F)[C@@H](F)C=O |
| InChI | InChI=1S/C10H10F2O/c1-7(10(12)6-13)8-4-2-3-5-9(8)11/h2-7,10H,1H3/t7-,10+/m1/s1 |
| InChIKey | YBRZIHHYXRKMST-XCBNKYQSSA-N |
| XLogP | 2.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|