C10H11FO — CID 134987463
(2R,3R)-2-fluoro-3-phenylbutanal (PubChem CID 134987463) has the molecular formula C10H11FO and a molecular weight of 166.19 g/mol. Its IUPAC name is (2R,3R)-2-fluoro-3-phenylbutanal.
| Compound Name | (2R,3R)-2-fluoro-3-phenylbutanal |
|---|---|
| PubChem CID | 134987463 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | (2R,3R)-2-fluoro-3-phenylbutanal |
| SMILES | C[C@H](c1ccccc1)[C@@H](F)C=O |
| InChI | InChI=1S/C10H11FO/c1-8(10(11)7-12)9-5-3-2-4-6-9/h2-8,10H,1H3/t8-,10+/m1/s1 |
| InChIKey | YVJOGTRWYHBXEI-SCZZXKLOSA-N |
| XLogP | 2.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|